C22H20N6O2 — CID 118128275
[2-(6-methoxy-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone (PubChem CID 118128275) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is [2-(6-methoxy-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [2-(6-methoxy-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 118128275 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [2-(6-methoxy-1H-benzimidazol-2-yl)-4-methylidenepyrrolidin-1-yl]-[2-(triazol-2-yl)phenyl]methanone |
| SMILES | C=C1CC(c2nc3ccc(OC)cc3[nH]2)N(C(=O)c2ccccc2-n2nccn2)C1 |
| InChI | InChI=1S/C22H20N6O2/c1-14-11-20(21-25-17-8-7-15(30-2)12-18(17)26-21)27(13-14)22(29)16-5-3-4-6-19(16)28-23-9-10-24-28/h3-10,12,20H,1,11,13H2,2H3,(H,25,26) |
| InChIKey | SLKDBHCQGPYVFB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|