C22H24N6O3 — CID 118127492
N-(2-amino-4-methoxyphenyl)-1-[5-methyl-2-(triazol-2-yl)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 118127492) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-(2-amino-4-methoxyphenyl)-1-[5-methyl-2-(triazol-2-yl)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(2-amino-4-methoxyphenyl)-1-[5-methyl-2-(triazol-2-yl)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118127492 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-(2-amino-4-methoxyphenyl)-1-[5-methyl-2-(triazol-2-yl)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN2C(=O)c2cc(C)ccc2-n2nccn2)c(N)c1 |
| InChI | InChI=1S/C22H24N6O3/c1-14-5-8-19(28-24-9-10-25-28)16(12-14)22(30)27-11-3-4-20(27)21(29)26-18-7-6-15(31-2)13-17(18)23/h5-10,12-13,20H,3-4,11,23H2,1-2H3,(H,26,29) |
| InChIKey | LOBRQAJIMHKKSD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|