C23H24O9S — CID 11812788
[(2S,4aR,6S,7R,8S,8aS)-7-acetyloxy-6-(benzenesulfonyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 11812788) has the molecular formula C23H24O9S and a molecular weight of 476.50 g/mol. Its IUPAC name is [(2S,4aR,6S,7R,8S,8aS)-7-acetyloxy-6-(benzenesulfonyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(2S,4aR,6S,7R,8S,8aS)-7-acetyloxy-6-(benzenesulfonyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 11812788 |
| Molecular Formula | C23H24O9S |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | [(2S,4aR,6S,7R,8S,8aS)-7-acetyloxy-6-(benzenesulfonyl)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](S(=O)(=O)c2ccccc2)O[C@@H]2CO[C@H](c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C23H24O9S/c1-14(24)29-20-19-18(13-28-22(32-19)16-9-5-3-6-10-16)31-23(21(20)30-15(2)25)33(26,27)17-11-7-4-8-12-17/h3-12,18-23H,13H2,1-2H3/t18-,19+,20+,21-,22+,23+/m1/s1 |
| InChIKey | MUEODSBJJMZDHE-YOCVKEFZSA-N |
| XLogP | 2.16 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |