C28H31F2N7O2 — CID 118128408
1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(1H-pyrazol-4-yl)pyrrolidin-3-yl]-3-[5-(3-methoxypropyl)-4-methyl-2-phenylpyrazol-3-yl]urea (PubChem CID 118128408) has the molecular formula C28H31F2N7O2 and a molecular weight of 535.60 g/mol. Its IUPAC name is 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(1H-pyrazol-4-yl)pyrrolidin-3-yl]-3-[5-(3-methoxypropyl)-4-methyl-2-phenylpyrazol-3-yl]urea.
| Compound Name | 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(1H-pyrazol-4-yl)pyrrolidin-3-yl]-3-[5-(3-methoxypropyl)-4-methyl-2-phenylpyrazol-3-yl]urea |
|---|---|
| PubChem CID | 118128408 |
| Molecular Formula | C28H31F2N7O2 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(1H-pyrazol-4-yl)pyrrolidin-3-yl]-3-[5-(3-methoxypropyl)-4-methyl-2-phenylpyrazol-3-yl]urea |
| SMILES | COCCCc1nn(-c2ccccc2)c(NC(=O)N[C@@H]2CN(c3cn[nH]c3)C[C@H]2c2ccc(F)c(F)c2)c1C |
| InChI | InChI=1S/C28H31F2N7O2/c1-18-25(9-6-12-39-2)35-37(20-7-4-3-5-8-20)27(18)34-28(38)33-26-17-36(21-14-31-32-15-21)16-22(26)19-10-11-23(29)24(30)13-19/h3-5,7-8,10-11,13-15,22,26H,6,9,12,16-17H2,1-2H3,(H,31,32)(H2,33,34,38)/t22-,26+/m0/s1 |
| InChIKey | SBIQHCIREUVMHO-BKMJKUGQSA-N |
| XLogP | 4.56 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|