C27H33F2N5O5S — CID 134197614
3-[5-[[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]oxypropane-1-sulfinic acid (PubChem CID 134197614) has the molecular formula C27H33F2N5O5S and a molecular weight of 577.65 g/mol. Its IUPAC name is 3-[5-[[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]oxypropane-1-sulfinic acid.
| Compound Name | 3-[5-[[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]oxypropane-1-sulfinic acid |
|---|---|
| PubChem CID | 134197614 |
| Molecular Formula | C27H33F2N5O5S |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 3-[5-[[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]oxypropane-1-sulfinic acid |
| SMILES | COCCN1C[C@@H](NC(=O)Nc2c(C)c(OCCCS(=O)O)nn2-c2ccccc2)[C@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C27H33F2N5O5S/c1-18-25(34(20-7-4-3-5-8-20)32-26(18)39-12-6-14-40(36)37)31-27(35)30-24-17-33(11-13-38-2)16-21(24)19-9-10-22(28)23(29)15-19/h3-5,7-10,15,21,24H,6,11-14,16-17H2,1-2H3,(H,36,37)(H2,30,31,35)/t21-,24+/m0/s1 |
| InChIKey | ZYMBIQFSIJFHLR-XUZZJYLKSA-N |
| XLogP | 3.69 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|