C25H26F2N6O2 — CID 153119748
1-[(3S,4R)-4-(3,4-difluorophenyl)-1-ethylpyrrolidin-3-yl]-3-[3-(isocyanomethoxy)-4-methyl-1-phenylpyrazol-5-yl]urea (PubChem CID 153119748) has the molecular formula C25H26F2N6O2 and a molecular weight of 480.52 g/mol. Its IUPAC name is 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-ethylpyrrolidin-3-yl]-3-[3-(isocyanomethoxy)-4-methyl-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-ethylpyrrolidin-3-yl]-3-[3-(isocyanomethoxy)-4-methyl-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 153119748 |
| Molecular Formula | C25H26F2N6O2 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-ethylpyrrolidin-3-yl]-3-[3-(isocyanomethoxy)-4-methyl-1-phenylpyrazol-5-yl]urea |
| SMILES | [C-]#[N+]COc1nn(-c2ccccc2)c(NC(=O)N[C@@H]2CN(CC)C[C@H]2c2ccc(F)c(F)c2)c1C |
| InChI | InChI=1S/C25H26F2N6O2/c1-4-32-13-19(17-10-11-20(26)21(27)12-17)22(14-32)29-25(34)30-23-16(2)24(35-15-28-3)31-33(23)18-8-6-5-7-9-18/h5-12,19,22H,4,13-15H2,1-2H3,(H2,29,30,34)/t19-,22+/m0/s1 |
| InChIKey | VUPNNNOWWLAWSJ-SIKLNZKXSA-N |
| XLogP | 4.32 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|