C25H27F2N5O4S — CID 71041240
1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]-3-(5,5-dioxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)urea (PubChem CID 71041240) has the molecular formula C25H27F2N5O4S and a molecular weight of 531.59 g/mol. Its IUPAC name is 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]-3-(5,5-dioxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)urea.
| Compound Name | 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]-3-(5,5-dioxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 71041240 |
| Molecular Formula | C25H27F2N5O4S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]-3-(5,5-dioxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)urea |
| SMILES | COCCN1C[C@@H](NC(=O)Nc2c3c(nn2-c2ccccc2)CS(=O)(=O)C3)[C@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C25H27F2N5O4S/c1-36-10-9-31-12-18(16-7-8-20(26)21(27)11-16)22(13-31)28-25(33)29-24-19-14-37(34,35)15-23(19)30-32(24)17-5-3-2-4-6-17/h2-8,11,18,22H,9-10,12-15H2,1H3,(H2,28,29,33)/t18-,22+/m0/s1 |
| InChIKey | VKMWRPDKSFQKCC-PGRDOPGGSA-N |
| XLogP | 2.81 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |