C28H27NO5S — CID 11812953
(4R,5S)-3-[(1S,2R,5S)-5-(benzenesulfonyl)-2-methoxy-2-methylcyclopent-3-en-1-yl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 11812953) has the molecular formula C28H27NO5S and a molecular weight of 489.59 g/mol. Its IUPAC name is (4R,5S)-3-[(1S,2R,5S)-5-(benzenesulfonyl)-2-methoxy-2-methylcyclopent-3-en-1-yl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(1S,2R,5S)-5-(benzenesulfonyl)-2-methoxy-2-methylcyclopent-3-en-1-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11812953 |
| Molecular Formula | C28H27NO5S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (4R,5S)-3-[(1S,2R,5S)-5-(benzenesulfonyl)-2-methoxy-2-methylcyclopent-3-en-1-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | CO[C@]1(C)C=C[C@H](S(=O)(=O)c2ccccc2)[C@H]1N1C(=O)O[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H27NO5S/c1-28(33-2)19-18-23(35(31,32)22-16-10-5-11-17-22)26(28)29-24(20-12-6-3-7-13-20)25(34-27(29)30)21-14-8-4-9-15-21/h3-19,23-26H,1-2H3/t23-,24+,25-,26+,28+/m0/s1 |
| InChIKey | ROEGGOBGFFPXDJ-ODJLISDOSA-N |
| XLogP | 5.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|