C13H19N3O5 — CID 118133798
2-(2,5-dioxopyrrol-1-yl)-N-[2-(3-methoxypropanoylamino)ethyl]propanamide (PubChem CID 118133798) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-N-[2-(3-methoxypropanoylamino)ethyl]propanamide.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-N-[2-(3-methoxypropanoylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 118133798 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-N-[2-(3-methoxypropanoylamino)ethyl]propanamide |
| SMILES | COCCC(=O)NCCNC(=O)C(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H19N3O5/c1-9(16-11(18)3-4-12(16)19)13(20)15-7-6-14-10(17)5-8-21-2/h3-4,9H,5-8H2,1-2H3,(H,14,17)(H,15,20) |
| InChIKey | ZRMBRICUUBMIMU-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|