C18H23N3O4 — CID 118134664
N'-hydroxy-4-[6-(3-hydroxy-3-methoxy-2,2-dimethylpropoxy)-3-pyridinyl]benzenecarboximidamide (PubChem CID 118134664) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N'-hydroxy-4-[6-(3-hydroxy-3-methoxy-2,2-dimethylpropoxy)-3-pyridinyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[6-(3-hydroxy-3-methoxy-2,2-dimethylpropoxy)-3-pyridinyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118134664 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N'-hydroxy-4-[6-(3-hydroxy-3-methoxy-2,2-dimethylpropoxy)-3-pyridinyl]benzenecarboximidamide |
| SMILES | COC(O)C(C)(C)COc1ccc(-c2ccc(/C(N)=N\O)cc2)cn1 |
| InChI | InChI=1S/C18H23N3O4/c1-18(2,17(22)24-3)11-25-15-9-8-14(10-20-15)12-4-6-13(7-5-12)16(19)21-23/h4-10,17,22-23H,11H2,1-3H3,(H2,19,21) |
| InChIKey | ISKZAWWRAMDPEV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|