About 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine
3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine (PubChem CID 118136489) has the molecular formula C7H15N5
and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine.
Molecular Properties
| Compound Name | 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine |
| PubChem CID | 118136489 |
| Molecular Formula | C7H15N5 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine |
| SMILES | [H]/N=C(\C=C(N)N)N1CCNCC1 |
| InChI | InChI=1S/C7H15N5/c8-6(9)5-7(10)12-3-1-11-2-4-12/h5,10-11H,1-4,8-9H2/b10-7+ |
| InChIKey | XAVMEJKYLWFPTD-JXMROGBWSA-N |
| XLogP | -1.37 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine?
The IUPAC name of 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine (CID 118136489) is 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine.
What is the SMILES notation for 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine?
The canonical SMILES for 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine is [H]/N=C(\C=C(N)N)N1CCNCC1.
What is the InChIKey of 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine?
The InChIKey is XAVMEJKYLWFPTD-JXMROGBWSA-N. The full InChI is InChI=1S/C7H15N5/c8-6(9)5-7(10)12-3-1-11-2-4-12/h5,10-11H,1-4,8-9H2/b10-7+.
What are the key properties of 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine?
3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine has a molecular weight of 169.23 g/mol, XLogP of -1.37, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-3-piperazin-1-ylprop-1-ene-1,1-diamine is sourced from PubChem (CID 118136489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).