C8H17N5 — CID 144622377
3-imino-3-(4-methylpiperazin-1-yl)prop-1-ene-1,1-diamine (PubChem CID 144622377) has the molecular formula C8H17N5 and a molecular weight of 183.26 g/mol. Its IUPAC name is 3-imino-3-(4-methylpiperazin-1-yl)prop-1-ene-1,1-diamine.
| Compound Name | 3-imino-3-(4-methylpiperazin-1-yl)prop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 144622377 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | 3-imino-3-(4-methylpiperazin-1-yl)prop-1-ene-1,1-diamine |
| SMILES | [H]/N=C(\C=C(N)N)N1CCN(C)CC1 |
| InChI | InChI=1S/C8H17N5/c1-12-2-4-13(5-3-12)8(11)6-7(9)10/h6,11H,2-5,9-10H2,1H3/b11-8+ |
| InChIKey | JGEUAXAIYAUXOS-DHZHZOJOSA-N |
| XLogP | -1.03 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|