C17H19N5O6 — CID 1181382
propan-2-yl (7S)-7-(4-hydroxy-3-methoxy-5-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 1181382) has the molecular formula C17H19N5O6 and a molecular weight of 389.37 g/mol. Its IUPAC name is propan-2-yl (7S)-7-(4-hydroxy-3-methoxy-5-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl (7S)-7-(4-hydroxy-3-methoxy-5-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 1181382 |
| Molecular Formula | C17H19N5O6 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | propan-2-yl (7S)-7-(4-hydroxy-3-methoxy-5-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COc1cc([C@H]2C(C(=O)OC(C)C)=C(C)Nc3ncnn32)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H19N5O6/c1-8(2)28-16(24)13-9(3)20-17-18-7-19-21(17)14(13)10-5-11(22(25)26)15(23)12(6-10)27-4/h5-8,14,23H,1-4H3,(H,18,19,20)/t14-/m0/s1 |
| InChIKey | PQVYCYOLUNYRNV-AWEZNQCLSA-N |
| XLogP | 2.14 |
| TPSA | 141.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|