C15H15N5O5 — CID 725483
ethyl (7R)-7-(4-hydroxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 725483) has the molecular formula C15H15N5O5 and a molecular weight of 345.32 g/mol. Its IUPAC name is ethyl (7R)-7-(4-hydroxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (7R)-7-(4-hydroxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 725483 |
| Molecular Formula | C15H15N5O5 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | ethyl (7R)-7-(4-hydroxy-3-nitrophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15N5O5/c1-3-25-14(22)12-8(2)18-15-16-7-17-19(15)13(12)9-4-5-11(21)10(6-9)20(23)24/h4-7,13,21H,3H2,1-2H3,(H,16,17,18)/t13-/m1/s1 |
| InChIKey | LTHYULLPASFQPP-CYBMUJFWSA-N |
| XLogP | 1.74 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|