C17H18N4O3 — CID 135707496
ethyl 7-(1,3-dihydro-2-benzofuran-5-yl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135707496) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is ethyl 7-(1,3-dihydro-2-benzofuran-5-yl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(1,3-dihydro-2-benzofuran-5-yl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135707496 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ethyl 7-(1,3-dihydro-2-benzofuran-5-yl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2ncnn2C1c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C17H18N4O3/c1-3-24-16(22)14-10(2)20-17-18-9-19-21(17)15(14)11-4-5-12-7-23-8-13(12)6-11/h4-6,9,15H,3,7-8H2,1-2H3,(H,18,19,20) |
| InChIKey | KAXDVIUSOCHNIH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |