C22H27N5O4 — CID 118138531
(2S)-2-amino-3-[4-[[N'-[[2-(3-hydroxypyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 118138531) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[[N'-[[2-(3-hydroxypyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[[N'-[[2-(3-hydroxypyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118138531 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (2S)-2-amino-3-[4-[[N'-[[2-(3-hydroxypyrrolidin-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | N/C(=N\Cc1ccccc1N1CCC(O)C1)NC(=O)c1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C22H27N5O4/c23-18(21(30)31)11-14-5-7-15(8-6-14)20(29)26-22(24)25-12-16-3-1-2-4-19(16)27-10-9-17(28)13-27/h1-8,17-18,28H,9-13,23H2,(H,30,31)(H3,24,25,26,29)/t17?,18-/m0/s1 |
| InChIKey | KNKFWTNOWYYFDK-ZVAWYAOSSA-N |
| XLogP | 0.46 |
| TPSA | 154.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|