C20H16Cl2FN2O8P — CID 118139745
[4-[[4,5-dichloro-2-(4-fluoro-2-methoxyphenoxy)benzoyl]amino]-2-oxo-1H-pyridin-3-yl]methyl dihydrogen phosphate (PubChem CID 118139745) has the molecular formula C20H16Cl2FN2O8P and a molecular weight of 533.23 g/mol. Its IUPAC name is [4-[[4,5-dichloro-2-(4-fluoro-2-methoxyphenoxy)benzoyl]amino]-2-oxo-1H-pyridin-3-yl]methyl dihydrogen phosphate.
| Compound Name | [4-[[4,5-dichloro-2-(4-fluoro-2-methoxyphenoxy)benzoyl]amino]-2-oxo-1H-pyridin-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118139745 |
| Molecular Formula | C20H16Cl2FN2O8P |
| Molecular Weight | 533.23 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | [4-[[4,5-dichloro-2-(4-fluoro-2-methoxyphenoxy)benzoyl]amino]-2-oxo-1H-pyridin-3-yl]methyl dihydrogen phosphate |
| SMILES | COc1cc(F)ccc1Oc1cc(Cl)c(Cl)cc1C(=O)Nc1cc[nH]c(=O)c1COP(=O)(O)O |
| InChI | InChI=1S/C20H16Cl2FN2O8P/c1-31-18-6-10(23)2-3-16(18)33-17-8-14(22)13(21)7-11(17)20(27)25-15-4-5-24-19(26)12(15)9-32-34(28,29)30/h2-8H,9H2,1H3,(H2,28,29,30)(H2,24,25,26,27) |
| InChIKey | CFONUDOULKEILV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 147.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.23 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|