C20H15F4N2O7P — CID 118139736
[4-[[2-(4-fluorophenoxy)-5-(trifluoromethyl)benzoyl]amino]-2-oxo-1H-pyridin-3-yl]methyl dihydrogen phosphate (PubChem CID 118139736) has the molecular formula C20H15F4N2O7P and a molecular weight of 502.31 g/mol. Its IUPAC name is [4-[[2-(4-fluorophenoxy)-5-(trifluoromethyl)benzoyl]amino]-2-oxo-1H-pyridin-3-yl]methyl dihydrogen phosphate.
| Compound Name | [4-[[2-(4-fluorophenoxy)-5-(trifluoromethyl)benzoyl]amino]-2-oxo-1H-pyridin-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118139736 |
| Molecular Formula | C20H15F4N2O7P |
| Molecular Weight | 502.31 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | [4-[[2-(4-fluorophenoxy)-5-(trifluoromethyl)benzoyl]amino]-2-oxo-1H-pyridin-3-yl]methyl dihydrogen phosphate |
| SMILES | O=C(Nc1cc[nH]c(=O)c1COP(=O)(O)O)c1cc(C(F)(F)F)ccc1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C20H15F4N2O7P/c21-12-2-4-13(5-3-12)33-17-6-1-11(20(22,23)24)9-14(17)19(28)26-16-7-8-25-18(27)15(16)10-32-34(29,30)31/h1-9H,10H2,(H2,29,30,31)(H2,25,26,27,28) |
| InChIKey | HZURWINTEPVAOL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|