C28H31F4N2O7P — CID 118151585
ditert-butyl [4-[[2-(4-fluorophenoxy)-5-(trifluoromethyl)benzoyl]amino]-2-oxo-1-pyridinyl]methyl phosphate (PubChem CID 118151585) has the molecular formula C28H31F4N2O7P and a molecular weight of 614.53 g/mol. Its IUPAC name is ditert-butyl [4-[[2-(4-fluorophenoxy)-5-(trifluoromethyl)benzoyl]amino]-2-oxo-1-pyridinyl]methyl phosphate.
| Compound Name | ditert-butyl [4-[[2-(4-fluorophenoxy)-5-(trifluoromethyl)benzoyl]amino]-2-oxo-1-pyridinyl]methyl phosphate |
|---|---|
| PubChem CID | 118151585 |
| Molecular Formula | C28H31F4N2O7P |
| Molecular Weight | 614.53 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | ditert-butyl [4-[[2-(4-fluorophenoxy)-5-(trifluoromethyl)benzoyl]amino]-2-oxo-1-pyridinyl]methyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCn1ccc(NC(=O)c2cc(C(F)(F)F)ccc2Oc2ccc(F)cc2)cc1=O)OC(C)(C)C |
| InChI | InChI=1S/C28H31F4N2O7P/c1-26(2,3)40-42(37,41-27(4,5)6)38-17-34-14-13-20(16-24(34)35)33-25(36)22-15-18(28(30,31)32)7-12-23(22)39-21-10-8-19(29)9-11-21/h7-16H,17H2,1-6H3,(H,33,36) |
| InChIKey | WWYGLMRYAPHUCC-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.53 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|