C27H25N3O3 — CID 118140924
[2-[[2-(2,6-dimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl] hex-4-ynoate (PubChem CID 118140924) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is [2-[[2-(2,6-dimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl] hex-4-ynoate.
| Compound Name | [2-[[2-(2,6-dimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl] hex-4-ynoate |
|---|---|
| PubChem CID | 118140924 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | [2-[[2-(2,6-dimethylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl] hex-4-ynoate |
| SMILES | CC#CCCC(=O)Oc1ccccc1OCc1ccc2nc(-c3c(C)cccc3C)nn2c1 |
| InChI | InChI=1S/C27H25N3O3/c1-4-5-6-14-25(31)33-23-13-8-7-12-22(23)32-18-21-15-16-24-28-27(29-30(24)17-21)26-19(2)10-9-11-20(26)3/h7-13,15-17H,6,14,18H2,1-3H3 |
| InChIKey | RDTPBQIKUSQQGK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|