C21H20N6O2 — CID 118141161
1-[4-(benzylamino)-5-methoxy-6-methylpyrimidin-2-yl]indazole-4-carboxamide (PubChem CID 118141161) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 1-[4-(benzylamino)-5-methoxy-6-methylpyrimidin-2-yl]indazole-4-carboxamide.
| Compound Name | 1-[4-(benzylamino)-5-methoxy-6-methylpyrimidin-2-yl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 118141161 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[4-(benzylamino)-5-methoxy-6-methylpyrimidin-2-yl]indazole-4-carboxamide |
| SMILES | COc1c(C)nc(-n2ncc3c(C(N)=O)cccc32)nc1NCc1ccccc1 |
| InChI | InChI=1S/C21H20N6O2/c1-13-18(29-2)20(23-11-14-7-4-3-5-8-14)26-21(25-13)27-17-10-6-9-15(19(22)28)16(17)12-24-27/h3-10,12H,11H2,1-2H3,(H2,22,28)(H,23,25,26) |
| InChIKey | DACMYQNZYZXQAB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |