C21H20N6O3S — CID 118141339
3-[5-amino-4-(benzylamino)pyrimidin-2-yl]-2-methylsulfonyl-1H-indole-4-carboxamide (PubChem CID 118141339) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 3-[5-amino-4-(benzylamino)pyrimidin-2-yl]-2-methylsulfonyl-1H-indole-4-carboxamide.
| Compound Name | 3-[5-amino-4-(benzylamino)pyrimidin-2-yl]-2-methylsulfonyl-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 118141339 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 3-[5-amino-4-(benzylamino)pyrimidin-2-yl]-2-methylsulfonyl-1H-indole-4-carboxamide |
| SMILES | CS(=O)(=O)c1[nH]c2cccc(C(N)=O)c2c1-c1ncc(N)c(NCc2ccccc2)n1 |
| InChI | InChI=1S/C21H20N6O3S/c1-31(29,30)21-17(16-13(18(23)28)8-5-9-15(16)26-21)20-25-11-14(22)19(27-20)24-10-12-6-3-2-4-7-12/h2-9,11,26H,10,22H2,1H3,(H2,23,28)(H,24,25,27) |
| InChIKey | GRHBWJDTPWTQJT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 156.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |