C23H23N5O2 — CID 118141353
3-[4-(benzylamino)-5-(methoxymethyl)pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (PubChem CID 118141353) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-[4-(benzylamino)-5-(methoxymethyl)pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide.
| Compound Name | 3-[4-(benzylamino)-5-(methoxymethyl)pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 118141353 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-[4-(benzylamino)-5-(methoxymethyl)pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide |
| SMILES | COCc1cnc(-c2c(C)[nH]c3cccc(C(N)=O)c23)nc1NCc1ccccc1 |
| InChI | InChI=1S/C23H23N5O2/c1-14-19(20-17(21(24)29)9-6-10-18(20)27-14)23-26-12-16(13-30-2)22(28-23)25-11-15-7-4-3-5-8-15/h3-10,12,27H,11,13H2,1-2H3,(H2,24,29)(H,25,26,28) |
| InChIKey | KCOVJBHLTTXABM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |