C25H34FN9O3 — CID 118142892
tert-butyl N-[2-[[[6-fluoro-4-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-2-pyridinyl]amino]carbamoyl]-4-methylpentyl]carbamate (PubChem CID 118142892) has the molecular formula C25H34FN9O3 and a molecular weight of 527.61 g/mol. Its IUPAC name is tert-butyl N-[2-[[[6-fluoro-4-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-2-pyridinyl]amino]carbamoyl]-4-methylpentyl]carbamate.
| Compound Name | tert-butyl N-[2-[[[6-fluoro-4-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-2-pyridinyl]amino]carbamoyl]-4-methylpentyl]carbamate |
|---|---|
| PubChem CID | 118142892 |
| Molecular Formula | C25H34FN9O3 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | tert-butyl N-[2-[[[6-fluoro-4-[2-[(2-methylpyrazol-3-yl)amino]pyrimidin-4-yl]-2-pyridinyl]amino]carbamoyl]-4-methylpentyl]carbamate |
| SMILES | CC(C)CC(CNC(=O)OC(C)(C)C)C(=O)NNc1cc(-c2ccnc(Nc3ccnn3C)n2)cc(F)n1 |
| InChI | InChI=1S/C25H34FN9O3/c1-15(2)11-17(14-28-24(37)38-25(3,4)5)22(36)34-33-20-13-16(12-19(26)31-20)18-7-9-27-23(30-18)32-21-8-10-29-35(21)6/h7-10,12-13,15,17H,11,14H2,1-6H3,(H,28,37)(H,31,33)(H,34,36)(H,27,30,32) |
| InChIKey | YEOPQLSDJRRNLU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|