C15H28N2O3 — CID 118143364
4-[dimethyl-[5-(2-methylprop-2-enoylamino)pentyl]azaniumyl]butanoate (PubChem CID 118143364) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-[dimethyl-[5-(2-methylprop-2-enoylamino)pentyl]azaniumyl]butanoate.
| Compound Name | 4-[dimethyl-[5-(2-methylprop-2-enoylamino)pentyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 118143364 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 4-[dimethyl-[5-(2-methylprop-2-enoylamino)pentyl]azaniumyl]butanoate |
| SMILES | C=C(C)C(=O)NCCCCC[N+](C)(C)CCCC(=O)[O-] |
| InChI | InChI=1S/C15H28N2O3/c1-13(2)15(20)16-10-6-5-7-11-17(3,4)12-8-9-14(18)19/h1,5-12H2,2-4H3,(H-,16,18,19,20) |
| InChIKey | LMCMZXXCONCMDI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|