C12H24N2O3 — CID 89401686
dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;propanoate (PubChem CID 89401686) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;propanoate.
| Compound Name | dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;propanoate |
|---|---|
| PubChem CID | 89401686 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;propanoate |
| SMILES | C=C(C)C(=O)NCCC[NH+](C)C.CCC(=O)[O-] |
| InChI | InChI=1S/C9H18N2O.C3H6O2/c1-8(2)9(12)10-6-5-7-11(3)4;1-2-3(4)5/h1,5-7H2,2-4H3,(H,10,12);2H2,1H3,(H,4,5) |
| InChIKey | SPFLUXVESLMZTR-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|