C17H16ClNO2 — CID 118143785
2-chloro-6-(3-methoxyphenyl)-6-methyl-7,8-dihydroquinolin-5-one (PubChem CID 118143785) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is 2-chloro-6-(3-methoxyphenyl)-6-methyl-7,8-dihydroquinolin-5-one.
| Compound Name | 2-chloro-6-(3-methoxyphenyl)-6-methyl-7,8-dihydroquinolin-5-one |
|---|---|
| PubChem CID | 118143785 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-chloro-6-(3-methoxyphenyl)-6-methyl-7,8-dihydroquinolin-5-one |
| SMILES | COc1cccc(C2(C)CCc3nc(Cl)ccc3C2=O)c1 |
| InChI | InChI=1S/C17H16ClNO2/c1-17(11-4-3-5-12(10-11)21-2)9-8-14-13(16(17)20)6-7-15(18)19-14/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | FCXHUNWKBKEWGY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|