C25H20ClN7O2 — CID 118146923
3-[4-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-(2-methylindazol-5-yl)benzamide (PubChem CID 118146923) has the molecular formula C25H20ClN7O2 and a molecular weight of 485.94 g/mol. Its IUPAC name is 3-[4-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-(2-methylindazol-5-yl)benzamide.
| Compound Name | 3-[4-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-(2-methylindazol-5-yl)benzamide |
|---|---|
| PubChem CID | 118146923 |
| Molecular Formula | C25H20ClN7O2 |
| Molecular Weight | 485.94 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 3-[4-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-(2-methylindazol-5-yl)benzamide |
| SMILES | Cn1cc2cc(NC(=O)c3cccc(-n4cc(NC(=O)Nc5ccccc5Cl)cn4)c3)ccc2n1 |
| InChI | InChI=1S/C25H20ClN7O2/c1-32-14-17-11-18(9-10-22(17)31-32)28-24(34)16-5-4-6-20(12-16)33-15-19(13-27-33)29-25(35)30-23-8-3-2-7-21(23)26/h2-15H,1H3,(H,28,34)(H2,29,30,35) |
| InChIKey | BLVSUXUTZYWETJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.94 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |