C23H18ClN5O3 — CID 118146800
(2-chlorophenyl) N-[1-[3-[(6-methyl-3-pyridinyl)carbamoyl]phenyl]pyrazol-4-yl]carbamate (PubChem CID 118146800) has the molecular formula C23H18ClN5O3 and a molecular weight of 447.88 g/mol. Its IUPAC name is (2-chlorophenyl) N-[1-[3-[(6-methyl-3-pyridinyl)carbamoyl]phenyl]pyrazol-4-yl]carbamate.
| Compound Name | (2-chlorophenyl) N-[1-[3-[(6-methyl-3-pyridinyl)carbamoyl]phenyl]pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 118146800 |
| Molecular Formula | C23H18ClN5O3 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (2-chlorophenyl) N-[1-[3-[(6-methyl-3-pyridinyl)carbamoyl]phenyl]pyrazol-4-yl]carbamate |
| SMILES | Cc1ccc(NC(=O)c2cccc(-n3cc(NC(=O)Oc4ccccc4Cl)cn3)c2)cn1 |
| InChI | InChI=1S/C23H18ClN5O3/c1-15-9-10-17(12-25-15)27-22(30)16-5-4-6-19(11-16)29-14-18(13-26-29)28-23(31)32-21-8-3-2-7-20(21)24/h2-14H,1H3,(H,27,30)(H,28,31) |
| InChIKey | ANTVVAXNZPFINR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |