C36H48N6O5S2 — CID 118147149
2,3-dihydro-1,3-thiazol-5-ylmethyl N-[5-[[3-methoxy-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]propanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 118147149) has the molecular formula C36H48N6O5S2 and a molecular weight of 708.95 g/mol. Its IUPAC name is 2,3-dihydro-1,3-thiazol-5-ylmethyl N-[5-[[3-methoxy-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]propanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 2,3-dihydro-1,3-thiazol-5-ylmethyl N-[5-[[3-methoxy-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]propanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 118147149 |
| Molecular Formula | C36H48N6O5S2 |
| Molecular Weight | 708.95 g/mol |
| Exact Mass | 708.31 |
| IUPAC Name | 2,3-dihydro-1,3-thiazol-5-ylmethyl N-[5-[[3-methoxy-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]propanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | COCC(NC(=O)N(C)Cc1csc(C(C)C)n1)C(=O)NC(CCC(Cc1ccccc1)NC(=O)OCC1=CNCS1)Cc1ccccc1 |
| InChI | InChI=1S/C36H48N6O5S2/c1-25(2)34-39-30(23-48-34)20-42(3)35(44)41-32(22-46-4)33(43)38-28(17-26-11-7-5-8-12-26)15-16-29(18-27-13-9-6-10-14-27)40-36(45)47-21-31-19-37-24-49-31/h5-14,19,23,25,28-29,32,37H,15-18,20-22,24H2,1-4H3,(H,38,43)(H,40,45)(H,41,44) |
| InChIKey | MBAIPXKUCOXUPO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 133.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.95 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |