C37H45N7O4S2 — CID 59784055
1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-4-cyano-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 59784055) has the molecular formula C37H45N7O4S2 and a molecular weight of 715.90 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-4-cyano-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-4-cyano-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 59784055 |
| Molecular Formula | C37H45N7O4S2 |
| Molecular Weight | 715.90 g/mol |
| Exact Mass | 715.30 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R)-5-[[(2S)-4-cyano-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)C1=NC(=CS1)CN(C)C(=O)N[C@@H](CCC#N)C(=O)N[C@H](CC[C@H](CC2=CC=CC=C2)NC(=O)OCC3=CN=CS3)CC4=CC=CC=C4 |
| InChI | InChI=1S/C37H45N7O4S2/c1-26(2)35-41-31(24-49-35)22-44(3)36(46)43-33(15-10-18-38)34(45)40-29(19-27-11-6-4-7-12-27)16-17-30(20-28-13-8-5-9-14-28)42-37(47)48-23-32-21-39-25-50-32/h4-9,11-14,21,24-26,29-30,33H,10,15-17,19-20,22-23H2,1-3H3,(H,40,45)(H,42,47)(H,43,46)/t29-,30-,33+/m1/s1 |
| InChIKey | VQFULAVAWCWTIL-QSCLJHCWSA-N |
| XLogP | 5.70 |
| TPSA | 206.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | 1090 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.90 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |