C38H49N5O4S2 — CID 58416960
1,3-thiazol-5-ylmethyl N-[(2S,5S,8S)-5-benzyl-8-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-7-oxo-1-phenylundecan-2-yl]carbamate (PubChem CID 58416960) has the molecular formula C38H49N5O4S2 and a molecular weight of 703.98 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2S,5S,8S)-5-benzyl-8-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-7-oxo-1-phenylundecan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2S,5S,8S)-5-benzyl-8-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-7-oxo-1-phenylundecan-2-yl]carbamate |
|---|---|
| PubChem CID | 58416960 |
| Molecular Formula | C38H49N5O4S2 |
| Molecular Weight | 703.98 g/mol |
| Exact Mass | 703.32 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2S,5S,8S)-5-benzyl-8-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-7-oxo-1-phenylundecan-2-yl]carbamate |
| SMILES | CCC[C@H](NC(=O)N(C)Cc1csc(C(C)C)n1)C(=O)CC(CC[C@@H](Cc1ccccc1)NC(=O)OCc1cncs1)Cc1ccccc1 |
| InChI | InChI=1S/C38H49N5O4S2/c1-5-12-34(42-37(45)43(4)23-32-25-48-36(40-32)27(2)3)35(44)21-30(19-28-13-8-6-9-14-28)17-18-31(20-29-15-10-7-11-16-29)41-38(46)47-24-33-22-39-26-49-33/h6-11,13-16,22,25-27,30-31,34H,5,12,17-21,23-24H2,1-4H3,(H,41,46)(H,42,45)/t30?,31-,34-/m0/s1 |
| InChIKey | IWSVSVUTDDWGFU-YFEPOZTLSA-N |
| XLogP | 8.17 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.98 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |