C37H45N5O5S2 — CID 58416888
1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-8-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-7,9-dioxo-1-phenyldecan-2-yl]carbamate (PubChem CID 58416888) has the molecular formula C37H45N5O5S2 and a molecular weight of 703.93 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-8-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-7,9-dioxo-1-phenyldecan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-8-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-7,9-dioxo-1-phenyldecan-2-yl]carbamate |
|---|---|
| PubChem CID | 58416888 |
| Molecular Formula | C37H45N5O5S2 |
| Molecular Weight | 703.93 g/mol |
| Exact Mass | 703.29 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-8-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]-7,9-dioxo-1-phenyldecan-2-yl]carbamate |
| SMILES | CC(=O)[C@H](NC(=O)N(C)Cc1csc(C(C)C)n1)C(=O)CC(CC[C@H](Cc1ccccc1)NC(=O)OCc1cncs1)Cc1ccccc1 |
| InChI | InChI=1S/C37H45N5O5S2/c1-25(2)35-39-31(23-48-35)21-42(4)36(45)41-34(26(3)43)33(44)19-29(17-27-11-7-5-8-12-27)15-16-30(18-28-13-9-6-10-14-28)40-37(46)47-22-32-20-38-24-49-32/h5-14,20,23-25,29-30,34H,15-19,21-22H2,1-4H3,(H,40,46)(H,41,45)/t29?,30-,34+/m1/s1 |
| InChIKey | SAXMIMKSBHWKMT-MUECWOBSSA-N |
| XLogP | 6.96 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.93 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|