C38H49N5O4S2 — CID 58416976
1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-9-methyl-8-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methylcarbamoyl]amino]-7-oxo-1-phenyldecan-2-yl]carbamate (PubChem CID 58416976) has the molecular formula C38H49N5O4S2 and a molecular weight of 703.98 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-9-methyl-8-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methylcarbamoyl]amino]-7-oxo-1-phenyldecan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-9-methyl-8-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methylcarbamoyl]amino]-7-oxo-1-phenyldecan-2-yl]carbamate |
|---|---|
| PubChem CID | 58416976 |
| Molecular Formula | C38H49N5O4S2 |
| Molecular Weight | 703.98 g/mol |
| Exact Mass | 703.32 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-9-methyl-8-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methylcarbamoyl]amino]-7-oxo-1-phenyldecan-2-yl]carbamate |
| SMILES | CC(C)c1nc(CNC(=O)N(C)[C@H](C(=O)CC(CC[C@H](Cc2ccccc2)NC(=O)OCc2cncs2)Cc2ccccc2)C(C)C)cs1 |
| InChI | InChI=1S/C38H49N5O4S2/c1-26(2)35(43(5)37(45)40-21-32-24-48-36(41-32)27(3)4)34(44)20-30(18-28-12-8-6-9-13-28)16-17-31(19-29-14-10-7-11-15-29)42-38(46)47-23-33-22-39-25-49-33/h6-15,22,24-27,30-31,35H,16-21,23H2,1-5H3,(H,40,45)(H,42,46)/t30?,31-,35+/m1/s1 |
| InChIKey | VJJQTPUGTLCNBN-ZPRQHYEISA-N |
| XLogP | 8.02 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.98 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |