C28H28F6O3 — CID 118156756
4-[1,1,1,2,2,3-hexafluoro-3,5-bis(4-hydroxyphenyl)decan-5-yl]phenol (PubChem CID 118156756) has the molecular formula C28H28F6O3 and a molecular weight of 526.52 g/mol. Its IUPAC name is 4-[1,1,1,2,2,3-hexafluoro-3,5-bis(4-hydroxyphenyl)decan-5-yl]phenol.
| Compound Name | 4-[1,1,1,2,2,3-hexafluoro-3,5-bis(4-hydroxyphenyl)decan-5-yl]phenol |
|---|---|
| PubChem CID | 118156756 |
| Molecular Formula | C28H28F6O3 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 4-[1,1,1,2,2,3-hexafluoro-3,5-bis(4-hydroxyphenyl)decan-5-yl]phenol |
| SMILES | CCCCCC(CC(F)(c1ccc(O)cc1)C(F)(F)C(F)(F)F)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C28H28F6O3/c1-2-3-4-17-25(19-5-11-22(35)12-6-19,20-7-13-23(36)14-8-20)18-26(29,27(30,31)28(32,33)34)21-9-15-24(37)16-10-21/h5-16,35-37H,2-4,17-18H2,1H3 |
| InChIKey | XYSLHDIHTGTZKF-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|