C9H13NO — CID 11815946
(8aS)-8-methyl-2,3,6,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 11815946) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (8aS)-8-methyl-2,3,6,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | (8aS)-8-methyl-2,3,6,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 11815946 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (8aS)-8-methyl-2,3,6,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | CC1=CCC(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C9H13NO/c1-7-4-5-9(11)10-6-2-3-8(7)10/h4,8H,2-3,5-6H2,1H3/t8-/m0/s1 |
| InChIKey | IRPQISJRGTUBDC-QMMMGPOBSA-N |
| XLogP | 1.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|