C18H18N4 — CID 118159679
4,12-dimethyl-5-[(1S)-1-phenylethyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 118159679) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4,12-dimethyl-5-[(1S)-1-phenylethyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 4,12-dimethyl-5-[(1S)-1-phenylethyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 118159679 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4,12-dimethyl-5-[(1S)-1-phenylethyl]-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1cc2c(ccc3nnc(C)n32)n1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H18N4/c1-12-11-17-16(9-10-18-20-19-14(3)22(17)18)21(12)13(2)15-7-5-4-6-8-15/h4-11,13H,1-3H3/t13-/m0/s1 |
| InChIKey | ARHCQIRNDNOFIW-ZDUSSCGKSA-N |
| XLogP | 3.91 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |