About methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate
methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate (PubChem CID 118160376) has the molecular formula C14H15F2NO4S
and a molecular weight of 331.34 g/mol. Its IUPAC name is methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate |
| PubChem CID | 118160376 |
| Molecular Formula | C14H15F2NO4S |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCCN2C(=O)C(F)(F)CC2C=O)s1 |
| InChI | InChI=1S/C14H15F2NO4S/c1-21-12(19)11-5-4-10(22-11)3-2-6-17-9(8-18)7-14(15,16)13(17)20/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | MWQMGGIEQKDMFH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate?
The IUPAC name of methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate (CID 118160376) is methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate?
The canonical SMILES for methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate is COC(=O)c1ccc(CCCN2C(=O)C(F)(F)CC2C=O)s1.
What is the InChIKey of methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate?
The InChIKey is MWQMGGIEQKDMFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2NO4S/c1-21-12(19)11-5-4-10(22-11)3-2-6-17-9(8-18)7-14(15,16)13(17)20/h4-5,8-9H,2-3,6-7H2,1H3.
What are the key properties of methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate?
methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate has a molecular weight of 331.34 g/mol, XLogP of 1.90, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate is sourced from PubChem (CID 118160376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).