C14H15F2NO4S — CID 118160376
methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate (PubChem CID 118160376) has the molecular formula C14H15F2NO4S and a molecular weight of 331.34 g/mol. Its IUPAC name is methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 118160376 |
| Molecular Formula | C14H15F2NO4S |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | methyl 5-[3-(3,3-difluoro-5-formyl-2-oxopyrrolidin-1-yl)propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCCN2C(=O)C(F)(F)CC2C=O)s1 |
| InChI | InChI=1S/C14H15F2NO4S/c1-21-12(19)11-5-4-10(22-11)3-2-6-17-9(8-18)7-14(15,16)13(17)20/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | MWQMGGIEQKDMFH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|