C12H15IN2O — CID 118161707
(1S,5R)-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)bicyclo[3.1.0]hexan-3-one (PubChem CID 118161707) has the molecular formula C12H15IN2O and a molecular weight of 330.17 g/mol. Its IUPAC name is (1S,5R)-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)bicyclo[3.1.0]hexan-3-one.
| Compound Name | (1S,5R)-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)bicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 118161707 |
| Molecular Formula | C12H15IN2O |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | (1S,5R)-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)bicyclo[3.1.0]hexan-3-one |
| SMILES | CC(C)n1nc(I)cc1C1[C@H]2CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C12H15IN2O/c1-6(2)15-10(5-11(13)14-15)12-8-3-7(16)4-9(8)12/h5-6,8-9,12H,3-4H2,1-2H3/t8-,9+,12? |
| InChIKey | FMKFFMREMSEBSD-USUYBEQLSA-N |
| XLogP | 2.76 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|