C19H13F3IN3O — CID 118163236
(3R)-N-(5-fluoro-4-iodo-3-pyridinyl)-3-(4-fluorophenyl)-3-(3-fluoro-4-pyridinyl)propanamide (PubChem CID 118163236) has the molecular formula C19H13F3IN3O and a molecular weight of 483.23 g/mol. Its IUPAC name is (3R)-N-(5-fluoro-4-iodo-3-pyridinyl)-3-(4-fluorophenyl)-3-(3-fluoro-4-pyridinyl)propanamide.
| Compound Name | (3R)-N-(5-fluoro-4-iodo-3-pyridinyl)-3-(4-fluorophenyl)-3-(3-fluoro-4-pyridinyl)propanamide |
|---|---|
| PubChem CID | 118163236 |
| Molecular Formula | C19H13F3IN3O |
| Molecular Weight | 483.23 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | (3R)-N-(5-fluoro-4-iodo-3-pyridinyl)-3-(4-fluorophenyl)-3-(3-fluoro-4-pyridinyl)propanamide |
| SMILES | O=C(C[C@H](c1ccc(F)cc1)c1ccncc1F)Nc1cncc(F)c1I |
| InChI | InChI=1S/C19H13F3IN3O/c20-12-3-1-11(2-4-12)14(13-5-6-24-8-15(13)21)7-18(27)26-17-10-25-9-16(22)19(17)23/h1-6,8-10,14H,7H2,(H,26,27)/t14-/m1/s1 |
| InChIKey | XKEQFYWDOAAEOH-CQSZACIVSA-N |
| XLogP | 4.66 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.23 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|