C17H18N2O3 — CID 118163587
methyl N-[(2S)-2-amino-3-(4-phenylphenyl)propanoyl]carbamate (PubChem CID 118163587) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is methyl N-[(2S)-2-amino-3-(4-phenylphenyl)propanoyl]carbamate.
| Compound Name | methyl N-[(2S)-2-amino-3-(4-phenylphenyl)propanoyl]carbamate |
|---|---|
| PubChem CID | 118163587 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | methyl N-[(2S)-2-amino-3-(4-phenylphenyl)propanoyl]carbamate |
| SMILES | COC(=O)NC(=O)[C@@H](N)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-22-17(21)19-16(20)15(18)11-12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-10,15H,11,18H2,1H3,(H,19,20,21)/t15-/m0/s1 |
| InChIKey | HHXKASZGRYIJEP-HNNXBMFYSA-N |
| XLogP | 2.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |