C13H24ClN5O4 — CID 118166070
3-N-[1,3-bis(2-methoxyethoxy)-2-methylpropan-2-yl]-6-chloro-1,2,4-triazine-3,5-diamine (PubChem CID 118166070) has the molecular formula C13H24ClN5O4 and a molecular weight of 349.82 g/mol. Its IUPAC name is 3-N-[1,3-bis(2-methoxyethoxy)-2-methylpropan-2-yl]-6-chloro-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[1,3-bis(2-methoxyethoxy)-2-methylpropan-2-yl]-6-chloro-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 118166070 |
| Molecular Formula | C13H24ClN5O4 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-N-[1,3-bis(2-methoxyethoxy)-2-methylpropan-2-yl]-6-chloro-1,2,4-triazine-3,5-diamine |
| SMILES | COCCOCC(C)(COCCOC)Nc1nnc(Cl)c(N)n1 |
| InChI | InChI=1S/C13H24ClN5O4/c1-13(8-22-6-4-20-2,9-23-7-5-21-3)17-12-16-11(15)10(14)18-19-12/h4-9H2,1-3H3,(H3,15,16,17,19) |
| InChIKey | ABPGIRIBSYIPBA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|