C30H30FN2O6S+ — CID 118167819
2-cyclopropyl-1-(4-fluorophenyl)sulfonyl-1-phenylmethoxycarbonylspiro[2H-indol-1-ium-3,4'-piperidine]-5-carboxylic acid (PubChem CID 118167819) has the molecular formula C30H30FN2O6S+ and a molecular weight of 565.64 g/mol. Its IUPAC name is 2-cyclopropyl-1-(4-fluorophenyl)sulfonyl-1-phenylmethoxycarbonylspiro[2H-indol-1-ium-3,4'-piperidine]-5-carboxylic acid.
| Compound Name | 2-cyclopropyl-1-(4-fluorophenyl)sulfonyl-1-phenylmethoxycarbonylspiro[2H-indol-1-ium-3,4'-piperidine]-5-carboxylic acid |
|---|---|
| PubChem CID | 118167819 |
| Molecular Formula | C30H30FN2O6S+ |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 2-cyclopropyl-1-(4-fluorophenyl)sulfonyl-1-phenylmethoxycarbonylspiro[2H-indol-1-ium-3,4'-piperidine]-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C1(CCNCC1)C(C1CC1)[N+]2(C(=O)OCc1ccccc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H29FN2O6S/c31-23-9-11-24(12-10-23)40(37,38)33(29(36)39-19-20-4-2-1-3-5-20)26-13-8-22(28(34)35)18-25(26)30(14-16-32-17-15-30)27(33)21-6-7-21/h1-5,8-13,18,21,27,32H,6-7,14-17,19H2/p+1 |
| InChIKey | SBBVICTYGHDWLM-UHFFFAOYSA-O |
| XLogP | 4.97 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|