C42H51N4O8P — CID 118168383
1-(3-tert-butyl-5-dimethylphosphorylphenyl)-3-[4-[[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]urea (PubChem CID 118168383) has the molecular formula C42H51N4O8P and a molecular weight of 770.86 g/mol. Its IUPAC name is 1-(3-tert-butyl-5-dimethylphosphorylphenyl)-3-[4-[[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]urea.
| Compound Name | 1-(3-tert-butyl-5-dimethylphosphorylphenyl)-3-[4-[[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 118168383 |
| Molecular Formula | C42H51N4O8P |
| Molecular Weight | 770.86 g/mol |
| Exact Mass | 770.34 |
| IUPAC Name | 1-(3-tert-butyl-5-dimethylphosphorylphenyl)-3-[4-[[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]urea |
| SMILES | COCCOCCOCCOc1cc(Nc2cc(Oc3ccc(NC(=O)Nc4cc(C(C)(C)C)cc(P(C)(C)=O)c4)c4ccccc34)ccn2)cc(OC)c1 |
| InChI | InChI=1S/C42H51N4O8P/c1-42(2,3)29-22-30(26-35(23-29)55(6,7)48)45-41(47)46-38-12-13-39(37-11-9-8-10-36(37)38)54-32-14-15-43-40(28-32)44-31-24-33(50-5)27-34(25-31)53-21-20-52-19-18-51-17-16-49-4/h8-15,22-28H,16-21H2,1-7H3,(H,43,44)(H2,45,46,47) |
| InChIKey | UDYNZGINEPJGRE-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.86 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|