C30H33N3O8 — CID 90159624
[4-[[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamic acid (PubChem CID 90159624) has the molecular formula C30H33N3O8 and a molecular weight of 563.61 g/mol. Its IUPAC name is [4-[[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamic acid.
| Compound Name | [4-[[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamic acid |
|---|---|
| PubChem CID | 90159624 |
| Molecular Formula | C30H33N3O8 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | [4-[[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamic acid |
| SMILES | COCCOCCOCCOc1cc(Nc2cc(Oc3ccc(NC(=O)O)c4ccccc34)ccn2)cc(OC)c1 |
| InChI | InChI=1S/C30H33N3O8/c1-36-11-12-38-13-14-39-15-16-40-24-18-21(17-23(19-24)37-2)32-29-20-22(9-10-31-29)41-28-8-7-27(33-30(34)35)25-5-3-4-6-26(25)28/h3-10,17-20,33H,11-16H2,1-2H3,(H,31,32)(H,34,35) |
| InChIKey | CLFDTNOASBSERF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|