C32H32N4O7 — CID 90422157
[4-[[2-[3-ethynyl-5-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamic acid (PubChem CID 90422157) has the molecular formula C32H32N4O7 and a molecular weight of 584.63 g/mol. Its IUPAC name is [4-[[2-[3-ethynyl-5-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamic acid.
| Compound Name | [4-[[2-[3-ethynyl-5-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamic acid |
|---|---|
| PubChem CID | 90422157 |
| Molecular Formula | C32H32N4O7 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | [4-[[2-[3-ethynyl-5-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]anilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamic acid |
| SMILES | C#Cc1cc(Nc2cc(Oc3ccc(NC(=O)O)c4ccccc34)ccn2)cc(C(=O)NCCOCCOCCOC)c1 |
| InChI | InChI=1S/C32H32N4O7/c1-3-22-18-23(31(37)34-12-13-41-16-17-42-15-14-40-2)20-24(19-22)35-30-21-25(10-11-33-30)43-29-9-8-28(36-32(38)39)26-6-4-5-7-27(26)29/h1,4-11,18-21,36H,12-17H2,2H3,(H,33,35)(H,34,37)(H,38,39) |
| InChIKey | ONLRRJHGHNBAKB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|