C31H33N5O5 — CID 166813162
3-ethynyl-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[[4-[4-(methylamino)naphthalen-1-yl]oxypyrimidin-2-yl]amino]benzamide (PubChem CID 166813162) has the molecular formula C31H33N5O5 and a molecular weight of 555.64 g/mol. Its IUPAC name is 3-ethynyl-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[[4-[4-(methylamino)naphthalen-1-yl]oxypyrimidin-2-yl]amino]benzamide.
| Compound Name | 3-ethynyl-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[[4-[4-(methylamino)naphthalen-1-yl]oxypyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 166813162 |
| Molecular Formula | C31H33N5O5 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | 3-ethynyl-N-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[[4-[4-(methylamino)naphthalen-1-yl]oxypyrimidin-2-yl]amino]benzamide |
| SMILES | C#Cc1cc(Nc2nccc(Oc3ccc(NC)c4ccccc34)n2)cc(C(=O)NCCOCCOCCOC)c1 |
| InChI | InChI=1S/C31H33N5O5/c1-4-22-19-23(30(37)33-13-14-39-17-18-40-16-15-38-3)21-24(20-22)35-31-34-12-11-29(36-31)41-28-10-9-27(32-2)25-7-5-6-8-26(25)28/h1,5-12,19-21,32H,13-18H2,2-3H3,(H,33,37)(H,34,35,36) |
| InChIKey | BOHFCXJDFVBUKQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|