C33H35N5O5 — CID 131743233
tert-butyl N-[4-[2-[3-ethynyl-5-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]oxynaphthalen-1-yl]carbamate (PubChem CID 131743233) has the molecular formula C33H35N5O5 and a molecular weight of 581.67 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[3-ethynyl-5-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]oxynaphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[3-ethynyl-5-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]oxynaphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 131743233 |
| Molecular Formula | C33H35N5O5 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | tert-butyl N-[4-[2-[3-ethynyl-5-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]oxynaphthalen-1-yl]carbamate |
| SMILES | C#Cc1cc(Nc2nccc(Oc3ccc(NC(=O)OC(C)(C)C)c4ccccc34)n2)cc(OCCN2CCOCC2)c1 |
| InChI | InChI=1S/C33H35N5O5/c1-5-23-20-24(22-25(21-23)41-19-16-38-14-17-40-18-15-38)35-31-34-13-12-30(37-31)42-29-11-10-28(26-8-6-7-9-27(26)29)36-32(39)43-33(2,3)4/h1,6-13,20-22H,14-19H2,2-4H3,(H,36,39)(H,34,35,37) |
| InChIKey | GCOBIBGMHIXVBM-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|