C43H45N9O4Si — CID 73330654
3-ethynyl-5-[[4-[4-[[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]carbamoylamino]naphthalen-1-yl]oxypyrimidin-2-yl]amino]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 73330654) has the molecular formula C43H45N9O4Si and a molecular weight of 779.98 g/mol. Its IUPAC name is 3-ethynyl-5-[[4-[4-[[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]carbamoylamino]naphthalen-1-yl]oxypyrimidin-2-yl]amino]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 3-ethynyl-5-[[4-[4-[[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]carbamoylamino]naphthalen-1-yl]oxypyrimidin-2-yl]amino]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 73330654 |
| Molecular Formula | C43H45N9O4Si |
| Molecular Weight | 779.98 g/mol |
| Exact Mass | 779.34 |
| IUPAC Name | 3-ethynyl-5-[[4-[4-[[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]carbamoylamino]naphthalen-1-yl]oxypyrimidin-2-yl]amino]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | C#Cc1cc(Nc2nccc(Oc3ccc(NC(=O)Nc4cc([Si](C)(C)C)nn4-c4ccc(C)cc4)c4ccccc34)n2)cc(C(=O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C43H45N9O4Si/c1-6-30-25-31(41(53)44-19-20-51-21-23-55-24-22-51)27-32(26-30)46-42-45-18-17-39(49-42)56-37-16-15-36(34-9-7-8-10-35(34)37)47-43(54)48-38-28-40(57(3,4)5)50-52(38)33-13-11-29(2)12-14-33/h1,7-18,25-28H,19-24H2,2-5H3,(H,44,53)(H,45,46,49)(H2,47,48,54) |
| InChIKey | YBTRJLBMEVYCEF-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 147.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.98 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|