C30H37N5O3Si — CID 11180295
1-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]-3-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]urea (PubChem CID 11180295) has the molecular formula C30H37N5O3Si and a molecular weight of 543.74 g/mol. Its IUPAC name is 1-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]-3-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]urea.
| Compound Name | 1-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]-3-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 11180295 |
| Molecular Formula | C30H37N5O3Si |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 1-[1-(4-methylphenyl)-3-trimethylsilylpyrazol-5-yl]-3-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]urea |
| SMILES | Cc1ccc(-n2nc([Si](C)(C)C)cc2NC(=O)Nc2ccc(OCCN3CCOCC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H37N5O3Si/c1-22-9-11-23(12-10-22)35-28(21-29(33-35)39(2,3)4)32-30(36)31-26-13-14-27(25-8-6-5-7-24(25)26)38-20-17-34-15-18-37-19-16-34/h5-14,21H,15-20H2,1-4H3,(H2,31,32,36) |
| InChIKey | WWTTXMQTJXMGQM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|